L-aspartic acid


(2S)-2-aminobutanedioic acid; aspartic acid; L-aspartic acid
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Asparaginsäure); p. 123, 787, 872, 995,
CAS RN:[56-84-8]
Formula:C4H7NO4; 133.10 g/mol
InChiKey:CKLJMWTZIZZHCS-REOHCLBHSA-N
SMILES:N[C@@H](CC(O)=O)C(O)=O
Molecular structure of L-aspartic acid
Density:1.660 g/mL
Molar volume:80.2 mL/mol
Melting point:230 °C
Log10 partition octanol / water:-3.89

Isomers

(S)-3-aminocarbonyl-2-hydroxypropanoic acid
Molecular structure of (S)-3-aminocarbonyl-2-hydroxypropanoic acid
4-amino-2-hydroxy-4-oxobutanoic acid
Molecular structure of 4-amino-2-hydroxy-4-oxobutanoic acid
2-amino-2-methylmalonic acid
Molecular structure of 2-amino-2-methylmalonic acid
D-aspartic acid
Molecular structure of D-aspartic acid
DL-aspartic acid
Molecular structure of DL-aspartic acid
L-aspartic acid
Molecular structure of L-aspartic acid
2-(carboxymethylamino)acetic acid
Molecular structure of 2-(carboxymethylamino)acetic acid
ethyl nitroacetate
Molecular structure of ethyl nitroacetate
ethyl 2-nitroacetate
Molecular structure of ethyl 2-nitroacetate